C24H30N2O11S — CID 129449201
ethyl 4-[[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]carbamothioylamino]benzoate (PubChem CID 129449201) has the molecular formula C24H30N2O11S and a molecular weight of 554.57 g/mol. Its IUPAC name is ethyl 4-[[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]carbamothioylamino]benzoate.
| Compound Name | ethyl 4-[[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 129449201 |
| Molecular Formula | C24H30N2O11S |
| Molecular Weight | 554.57 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | ethyl 4-[[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)N[C@@H]2O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C24H30N2O11S/c1-6-32-23(31)16-7-9-17(10-8-16)25-24(38)26-22-21(36-15(5)30)20(35-14(4)29)19(34-13(3)28)18(37-22)11-33-12(2)27/h7-10,18-22H,6,11H2,1-5H3,(H2,25,26,38)/t18-,19+,20+,21-,22-/m1/s1 |
| InChIKey | ARPVHNFYZHWCNQ-CDJZJNNCSA-N |
| XLogP | 1.23 |
| TPSA | 164.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.57 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|