C21H26N2O9S — CID 4014881
ethyl 4-[(3,4,5-triacetyloxyoxan-2-yl)carbamothioylamino]benzoate (PubChem CID 4014881) has the molecular formula C21H26N2O9S and a molecular weight of 482.51 g/mol. Its IUPAC name is ethyl 4-[(3,4,5-triacetyloxyoxan-2-yl)carbamothioylamino]benzoate.
| Compound Name | ethyl 4-[(3,4,5-triacetyloxyoxan-2-yl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 4014881 |
| Molecular Formula | C21H26N2O9S |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | ethyl 4-[(3,4,5-triacetyloxyoxan-2-yl)carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)NC2OCC(OC(C)=O)C(OC(C)=O)C2OC(C)=O)cc1 |
| InChI | InChI=1S/C21H26N2O9S/c1-5-28-20(27)14-6-8-15(9-7-14)22-21(33)23-19-18(32-13(4)26)17(31-12(3)25)16(10-29-19)30-11(2)24/h6-9,16-19H,5,10H2,1-4H3,(H2,22,23,33) |
| InChIKey | ZUJOUWMKSQZTEG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 138.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|