C19H21N3O7S2 — CID 88827521
[(3R,4R,5S,6R)-4,5-diacetyloxy-6-(1,3-benzothiazol-2-ylcarbamothioylamino)oxan-3-yl] acetate (PubChem CID 88827521) has the molecular formula C19H21N3O7S2 and a molecular weight of 467.53 g/mol. Its IUPAC name is [(3R,4R,5S,6R)-4,5-diacetyloxy-6-(1,3-benzothiazol-2-ylcarbamothioylamino)oxan-3-yl] acetate.
| Compound Name | [(3R,4R,5S,6R)-4,5-diacetyloxy-6-(1,3-benzothiazol-2-ylcarbamothioylamino)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 88827521 |
| Molecular Formula | C19H21N3O7S2 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | [(3R,4R,5S,6R)-4,5-diacetyloxy-6-(1,3-benzothiazol-2-ylcarbamothioylamino)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@H](OC(C)=O)CO[C@H]1NC(=S)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C19H21N3O7S2/c1-9(23)27-13-8-26-17(16(29-11(3)25)15(13)28-10(2)24)21-18(30)22-19-20-12-6-4-5-7-14(12)31-19/h4-7,13,15-17H,8H2,1-3H3,(H2,20,21,22,30)/t13-,15-,16+,17-/m1/s1 |
| InChIKey | GRENYIKKRXZFJH-MXASKKJJSA-N |
| XLogP | 1.73 |
| TPSA | 125.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|