C16H25NO8S — CID 7614542
[(3R,4R,5S,6S)-4,5-diacetyloxy-6-(butoxycarbothioylamino)oxan-3-yl] acetate (PubChem CID 7614542) has the molecular formula C16H25NO8S and a molecular weight of 391.44 g/mol. Its IUPAC name is [(3R,4R,5S,6S)-4,5-diacetyloxy-6-(butoxycarbothioylamino)oxan-3-yl] acetate.
| Compound Name | [(3R,4R,5S,6S)-4,5-diacetyloxy-6-(butoxycarbothioylamino)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 7614542 |
| Molecular Formula | C16H25NO8S |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | [(3R,4R,5S,6S)-4,5-diacetyloxy-6-(butoxycarbothioylamino)oxan-3-yl] acetate |
| SMILES | CCCCOC(=S)N[C@H]1OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H25NO8S/c1-5-6-7-21-16(26)17-15-14(25-11(4)20)13(24-10(3)19)12(8-22-15)23-9(2)18/h12-15H,5-8H2,1-4H3,(H,17,26)/t12-,13-,14+,15+/m1/s1 |
| InChIKey | JAMUNSUIXBIERM-KBXIAJHMSA-N |
| XLogP | 0.83 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|