C9H17NO5S — CID 26476171
O-propyl N-[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]carbamothioate (PubChem CID 26476171) has the molecular formula C9H17NO5S and a molecular weight of 251.30 g/mol. Its IUPAC name is O-propyl N-[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]carbamothioate.
| Compound Name | O-propyl N-[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]carbamothioate |
|---|---|
| PubChem CID | 26476171 |
| Molecular Formula | C9H17NO5S |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | O-propyl N-[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]carbamothioate |
| SMILES | CCCOC(=S)N[C@@H]1OC[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H17NO5S/c1-2-3-14-9(16)10-8-7(13)6(12)5(11)4-15-8/h5-8,11-13H,2-4H2,1H3,(H,10,16)/t5-,6+,7-,8+/m0/s1 |
| InChIKey | NMCPBQUOPSPCMI-FKSUSPILSA-N |
| XLogP | -1.27 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|