C12H24O5 — CID 70514431
(2S,3R,4S,5R)-2-heptoxyoxane-3,4,5-triol (PubChem CID 70514431) has the molecular formula C12H24O5 and a molecular weight of 248.32 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-heptoxyoxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R)-2-heptoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 70514431 |
| Molecular Formula | C12H24O5 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | (2S,3R,4S,5R)-2-heptoxyoxane-3,4,5-triol |
| SMILES | CCCCCCCO[C@H]1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H24O5/c1-2-3-4-5-6-7-16-12-11(15)10(14)9(13)8-17-12/h9-15H,2-8H2,1H3/t9-,10+,11-,12+/m1/s1 |
| InChIKey | VPZOXBIXIXVLTM-KXNHARMFSA-N |
| XLogP | 0.41 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|