C28H52O8 — CID 157491589
(3S,3aR,6R,6aR)-6-octoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol;(3R,3aR,6S,6aR)-6-octoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 157491589) has the molecular formula C28H52O8 and a molecular weight of 516.72 g/mol. Its IUPAC name is (3S,3aR,6R,6aR)-6-octoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol;(3R,3aR,6S,6aR)-6-octoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3S,3aR,6R,6aR)-6-octoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol;(3R,3aR,6S,6aR)-6-octoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 157491589 |
| Molecular Formula | C28H52O8 |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 516.37 |
| IUPAC Name | (3S,3aR,6R,6aR)-6-octoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol;(3R,3aR,6S,6aR)-6-octoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | CCCCCCCCO[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2O.CCCCCCCCO[C@H]1CO[C@H]2[C@@H]1OC[C@H]2O |
| InChI | InChI=1S/2C14H26O4/c2*1-2-3-4-5-6-7-8-16-12-10-18-13-11(15)9-17-14(12)13/h2*11-15H,2-10H2,1H3/t11-,12+,13+,14+;11-,12+,13-,14-/m01/s1 |
| InChIKey | BXILOCIJHYWELB-IEYHZUMWSA-N |
| XLogP | 3.78 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|