C14H26N2O4 — CID 123273171
(3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) N'-heptylcarbamimidate (PubChem CID 123273171) has the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. Its IUPAC name is (3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) N'-heptylcarbamimidate.
| Compound Name | (3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) N'-heptylcarbamimidate |
|---|---|
| PubChem CID | 123273171 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) N'-heptylcarbamimidate |
| SMILES | CCCCCCC/N=C(\N)OC1COC2C(O)COC12 |
| InChI | InChI=1S/C14H26N2O4/c1-2-3-4-5-6-7-16-14(15)20-11-9-19-12-10(17)8-18-13(11)12/h10-13,17H,2-9H2,1H3,(H2,15,16) |
| InChIKey | DLFYWQZEQQIRIG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|