C20H33NO6 — CID 71181576
(3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) 1-octanoylpiperidine-2-carboxylate (PubChem CID 71181576) has the molecular formula C20H33NO6 and a molecular weight of 383.49 g/mol. Its IUPAC name is (3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) 1-octanoylpiperidine-2-carboxylate.
| Compound Name | (3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) 1-octanoylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 71181576 |
| Molecular Formula | C20H33NO6 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | (3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) 1-octanoylpiperidine-2-carboxylate |
| SMILES | CCCCCCCC(=O)N1CCCCC1C(=O)OC1COC2C(O)COC12 |
| InChI | InChI=1S/C20H33NO6/c1-2-3-4-5-6-10-17(23)21-11-8-7-9-14(21)20(24)27-16-13-26-18-15(22)12-25-19(16)18/h14-16,18-19,22H,2-13H2,1H3 |
| InChIKey | VPLLFAMYHXDWQE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|