potassium (2S)-1-tetradecanoylpyrrolidine-2-carboxylate

C19H34KNO3 — CID 177344572

IUPACpotassium (2S)-1-tetradecanoylpyrrolidine-2-carboxylate
SMILESCCCCCCCCCCCCCC(=O)N1CCC[C@H]1C(=O)[O-].[K+]
InChIInChI=1S/C19H35NO3.K/c1-2-3-4-5-6-7-8-9-10-11-12-15-18(21)20-16-13-14-17(20)19(22)23;/h17H,2-16H2,1H3,(H,22,23);/q;+1/p-1/t17-;/m0./s1
InChIKeyOKBDDYZANCSJDA-LMOVPXPDSA-M
MW363.58 g/mol
LogP0.43
Rot. Bonds13

About potassium (2S)-1-tetradecanoylpyrrolidine-2-carboxylate

potassium (2S)-1-tetradecanoylpyrrolidine-2-carboxylate (PubChem CID 177344572) has the molecular formula C19H34KNO3 and a molecular weight of 363.58 g/mol. Its IUPAC name is potassium (2S)-1-tetradecanoylpyrrolidine-2-carboxylate.

Molecular Properties

Compound Namepotassium (2S)-1-tetradecanoylpyrrolidine-2-carboxylate
PubChem CID177344572
Molecular FormulaC19H34KNO3
Molecular Weight363.58 g/mol
Exact Mass363.22
IUPAC Namepotassium (2S)-1-tetradecanoylpyrrolidine-2-carboxylate
SMILESCCCCCCCCCCCCCC(=O)N1CCC[C@H]1C(=O)[O-].[K+]
InChIInChI=1S/C19H35NO3.K/c1-2-3-4-5-6-7-8-9-10-11-12-15-18(21)20-16-13-14-17(20)19(22)23;/h17H,2-16H2,1H3,(H,22,23);/q;+1/p-1/t17-;/m0./s1
InChIKeyOKBDDYZANCSJDA-LMOVPXPDSA-M
XLogP0.43
TPSA60.44 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds13
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500363.58
LogP ≤ 50.43
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze potassium (2S)-1-tetradecanoylpyrrolidine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium (2S)-1-tetradecanoylpyrrolidine-2-carboxylate?
The IUPAC name of potassium (2S)-1-tetradecanoylpyrrolidine-2-carboxylate (CID 177344572) is potassium (2S)-1-tetradecanoylpyrrolidine-2-carboxylate.
What is the SMILES notation for potassium (2S)-1-tetradecanoylpyrrolidine-2-carboxylate?
The canonical SMILES for potassium (2S)-1-tetradecanoylpyrrolidine-2-carboxylate is CCCCCCCCCCCCCC(=O)N1CCC[C@H]1C(=O)[O-].[K+].
What is the InChIKey of potassium (2S)-1-tetradecanoylpyrrolidine-2-carboxylate?
The InChIKey is OKBDDYZANCSJDA-LMOVPXPDSA-M. The full InChI is InChI=1S/C19H35NO3.K/c1-2-3-4-5-6-7-8-9-10-11-12-15-18(21)20-16-13-14-17(20)19(22)23;/h17H,2-16H2,1H3,(H,22,23);/q;+1/p-1/t17-;/m0./s1.
What are the key properties of potassium (2S)-1-tetradecanoylpyrrolidine-2-carboxylate?
potassium (2S)-1-tetradecanoylpyrrolidine-2-carboxylate has a molecular weight of 363.58 g/mol, XLogP of 0.43, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium (2S)-1-tetradecanoylpyrrolidine-2-carboxylate is sourced from PubChem (CID 177344572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).