C23H41NO3 — CID 54443907
(2S)-1-octadec-9-enoylpyrrolidine-2-carboxylic acid (PubChem CID 54443907) has the molecular formula C23H41NO3 and a molecular weight of 379.59 g/mol. Its IUPAC name is (2S)-1-octadec-9-enoylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-octadec-9-enoylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 54443907 |
| Molecular Formula | C23H41NO3 |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.31 |
| IUPAC Name | (2S)-1-octadec-9-enoylpyrrolidine-2-carboxylic acid |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C23H41NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-22(25)24-20-17-18-21(24)23(26)27/h9-10,21H,2-8,11-20H2,1H3,(H,26,27)/t21-/m0/s1 |
| InChIKey | WQCMZYCKACKLDL-NRFANRHFSA-N |
| XLogP | 6.10 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|