C24H41NO3 — CID 154068139
methyl 1-octadeca-9,12-dienoylpyrrolidine-2-carboxylate (PubChem CID 154068139) has the molecular formula C24H41NO3 and a molecular weight of 391.60 g/mol. Its IUPAC name is methyl 1-octadeca-9,12-dienoylpyrrolidine-2-carboxylate.
| Compound Name | methyl 1-octadeca-9,12-dienoylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 154068139 |
| Molecular Formula | C24H41NO3 |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.31 |
| IUPAC Name | methyl 1-octadeca-9,12-dienoylpyrrolidine-2-carboxylate |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)N1CCCC1C(=O)OC |
| InChI | InChI=1S/C24H41NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-23(26)25-21-18-19-22(25)24(27)28-2/h7-8,10-11,22H,3-6,9,12-21H2,1-2H3 |
| InChIKey | SGGPAMPJEMRVHL-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|