C20H35N3O5 — CID 22294726
methyl (2S)-1-[2-[[2-(decanoylamino)acetyl]amino]acetyl]pyrrolidine-2-carboxylate (PubChem CID 22294726) has the molecular formula C20H35N3O5 and a molecular weight of 397.52 g/mol. Its IUPAC name is methyl (2S)-1-[2-[[2-(decanoylamino)acetyl]amino]acetyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[2-[[2-(decanoylamino)acetyl]amino]acetyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 22294726 |
| Molecular Formula | C20H35N3O5 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | methyl (2S)-1-[2-[[2-(decanoylamino)acetyl]amino]acetyl]pyrrolidine-2-carboxylate |
| SMILES | CCCCCCCCCC(=O)NCC(=O)NCC(=O)N1CCC[C@H]1C(=O)OC |
| InChI | InChI=1S/C20H35N3O5/c1-3-4-5-6-7-8-9-12-17(24)21-14-18(25)22-15-19(26)23-13-10-11-16(23)20(27)28-2/h16H,3-15H2,1-2H3,(H,21,24)(H,22,25)/t16-/m0/s1 |
| InChIKey | VUGUDFSBXDBIRD-INIZCTEOSA-N |
| XLogP | 1.52 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|