C15H24O6 — CID 77273169
(3-butanoyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) pentanoate (PubChem CID 77273169) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is (3-butanoyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) pentanoate.
| Compound Name | (3-butanoyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) pentanoate |
|---|---|
| PubChem CID | 77273169 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (3-butanoyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) pentanoate |
| SMILES | CCCCC(=O)OC1COC2C(OC(=O)CCC)COC12 |
| InChI | InChI=1S/C15H24O6/c1-3-5-7-13(17)21-11-9-19-14-10(8-18-15(11)14)20-12(16)6-4-2/h10-11,14-15H,3-9H2,1-2H3 |
| InChIKey | ROJOQWZWNNXBQI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |