C18H32N2O12 — CID 89160595
[(3R,6R,6aR)-6-[5-(dihydroxyamino)oxyhexanoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 5-(dihydroxyamino)oxyhexanoate (PubChem CID 89160595) has the molecular formula C18H32N2O12 and a molecular weight of 468.46 g/mol. Its IUPAC name is [(3R,6R,6aR)-6-[5-(dihydroxyamino)oxyhexanoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 5-(dihydroxyamino)oxyhexanoate.
| Compound Name | [(3R,6R,6aR)-6-[5-(dihydroxyamino)oxyhexanoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 5-(dihydroxyamino)oxyhexanoate |
|---|---|
| PubChem CID | 89160595 |
| Molecular Formula | C18H32N2O12 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | [(3R,6R,6aR)-6-[5-(dihydroxyamino)oxyhexanoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 5-(dihydroxyamino)oxyhexanoate |
| SMILES | CC(CCCC(=O)O[C@@H]1CO[C@H]2C1OC[C@H]2OC(=O)CCCC(C)ON(O)O)ON(O)O |
| InChI | InChI=1S/C18H32N2O12/c1-11(31-19(23)24)5-3-7-15(21)29-13-9-27-18-14(10-28-17(13)18)30-16(22)8-4-6-12(2)32-20(25)26/h11-14,17-18,23-26H,3-10H2,1-2H3/t11?,12?,13-,14-,17-,18?/m1/s1 |
| InChIKey | VLEKEJFLWPMGBB-CHQSSONGSA-N |
| XLogP | 0.75 |
| TPSA | 176.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|