C13H20O6 — CID 118047556
(3-propanoyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) 2-methylpropanoate (PubChem CID 118047556) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is (3-propanoyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) 2-methylpropanoate.
| Compound Name | (3-propanoyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 118047556 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (3-propanoyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) 2-methylpropanoate |
| SMILES | CCC(=O)OC1COC2C(OC(=O)C(C)C)COC12 |
| InChI | InChI=1S/C13H20O6/c1-4-10(14)18-8-5-16-12-9(6-17-11(8)12)19-13(15)7(2)3/h7-9,11-12H,4-6H2,1-3H3 |
| InChIKey | XJBGGYXBOLGYDG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |