C18H34N2O6+2 — CID 140638767
[1-[[6-(2-azaniumyl-4-methylpentanoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-4-methyl-1-oxopentan-2-yl]azanium (PubChem CID 140638767) has the molecular formula C18H34N2O6+2 and a molecular weight of 374.48 g/mol. Its IUPAC name is [1-[[6-(2-azaniumyl-4-methylpentanoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-4-methyl-1-oxopentan-2-yl]azanium.
| Compound Name | [1-[[6-(2-azaniumyl-4-methylpentanoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-4-methyl-1-oxopentan-2-yl]azanium |
|---|---|
| PubChem CID | 140638767 |
| Molecular Formula | C18H34N2O6+2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | [1-[[6-(2-azaniumyl-4-methylpentanoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-4-methyl-1-oxopentan-2-yl]azanium |
| SMILES | CC(C)CC([NH3+])C(=O)OC1COC2C(OC(=O)C([NH3+])CC(C)C)COC12 |
| InChI | InChI=1S/C18H32N2O6/c1-9(2)5-11(19)17(21)25-13-7-23-16-14(8-24-15(13)16)26-18(22)12(20)6-10(3)4/h9-16H,5-8,19-20H2,1-4H3/p+2 |
| InChIKey | ILPMNCYBSBSZPS-UHFFFAOYSA-P |
| XLogP | -1.08 |
| TPSA | 126.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |