C18H28N2O8 — CID 118403221
[6-[2-(2-methylpropanoylamino)acetyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-(2-methylpropanoylamino)acetate (PubChem CID 118403221) has the molecular formula C18H28N2O8 and a molecular weight of 400.43 g/mol. Its IUPAC name is [6-[2-(2-methylpropanoylamino)acetyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-(2-methylpropanoylamino)acetate.
| Compound Name | [6-[2-(2-methylpropanoylamino)acetyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-(2-methylpropanoylamino)acetate |
|---|---|
| PubChem CID | 118403221 |
| Molecular Formula | C18H28N2O8 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | [6-[2-(2-methylpropanoylamino)acetyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-(2-methylpropanoylamino)acetate |
| SMILES | CC(C)C(=O)NCC(=O)OC1COC2C(OC(=O)CNC(=O)C(C)C)COC12 |
| InChI | InChI=1S/C18H28N2O8/c1-9(2)17(23)19-5-13(21)27-11-7-25-16-12(8-26-15(11)16)28-14(22)6-20-18(24)10(3)4/h9-12,15-16H,5-8H2,1-4H3,(H,19,23)(H,20,24) |
| InChIKey | ODBWOROKZFWQNW-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |