C15H26N2O6 — CID 163451146
[(3R,3aR,6S,6aR)-3-(propan-2-ylcarbamoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-tert-butylcarbamate (PubChem CID 163451146) has the molecular formula C15H26N2O6 and a molecular weight of 330.38 g/mol. Its IUPAC name is [(3R,3aR,6S,6aR)-3-(propan-2-ylcarbamoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-tert-butylcarbamate.
| Compound Name | [(3R,3aR,6S,6aR)-3-(propan-2-ylcarbamoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 163451146 |
| Molecular Formula | C15H26N2O6 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | [(3R,3aR,6S,6aR)-3-(propan-2-ylcarbamoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-tert-butylcarbamate |
| SMILES | CC(C)NC(=O)O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2OC(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H26N2O6/c1-8(2)16-13(18)22-9-6-20-12-10(7-21-11(9)12)23-14(19)17-15(3,4)5/h8-12H,6-7H2,1-5H3,(H,16,18)(H,17,19)/t9-,10+,11-,12-/m1/s1 |
| InChIKey | BGSIDLQKMCHHQB-WRWGMCAJSA-N |
| XLogP | 1.18 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |