About oxiran-2-ylmethyl N-propan-2-ylcarbamate
oxiran-2-ylmethyl N-propan-2-ylcarbamate (PubChem CID 19812627) has the molecular formula C7H13NO3
and a molecular weight of 159.18 g/mol. Its IUPAC name is oxiran-2-ylmethyl N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | oxiran-2-ylmethyl N-propan-2-ylcarbamate |
| PubChem CID | 19812627 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | oxiran-2-ylmethyl N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)OCC1CO1 |
| InChI | InChI=1S/C7H13NO3/c1-5(2)8-7(9)11-4-6-3-10-6/h5-6H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | ALEPOPHIUSQKBV-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxiran-2-ylmethyl N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxiran-2-ylmethyl N-propan-2-ylcarbamate?
The IUPAC name of oxiran-2-ylmethyl N-propan-2-ylcarbamate (CID 19812627) is oxiran-2-ylmethyl N-propan-2-ylcarbamate.
What is the SMILES notation for oxiran-2-ylmethyl N-propan-2-ylcarbamate?
The canonical SMILES for oxiran-2-ylmethyl N-propan-2-ylcarbamate is CC(C)NC(=O)OCC1CO1.
What is the InChIKey of oxiran-2-ylmethyl N-propan-2-ylcarbamate?
The InChIKey is ALEPOPHIUSQKBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3/c1-5(2)8-7(9)11-4-6-3-10-6/h5-6H,3-4H2,1-2H3,(H,8,9).
What are the key properties of oxiran-2-ylmethyl N-propan-2-ylcarbamate?
oxiran-2-ylmethyl N-propan-2-ylcarbamate has a molecular weight of 159.18 g/mol, XLogP of 0.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxiran-2-ylmethyl N-propan-2-ylcarbamate is sourced from PubChem (CID 19812627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).