C18H32N2O6 — CID 101024949
[(3R,6R)-6-[(2S,3S)-2-amino-3-methylpentanoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] (2S,3S)-2-amino-3-methylpentanoate (PubChem CID 101024949) has the molecular formula C18H32N2O6 and a molecular weight of 372.46 g/mol. Its IUPAC name is [(3R,6R)-6-[(2S,3S)-2-amino-3-methylpentanoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] (2S,3S)-2-amino-3-methylpentanoate.
| Compound Name | [(3R,6R)-6-[(2S,3S)-2-amino-3-methylpentanoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] (2S,3S)-2-amino-3-methylpentanoate |
|---|---|
| PubChem CID | 101024949 |
| Molecular Formula | C18H32N2O6 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | [(3R,6R)-6-[(2S,3S)-2-amino-3-methylpentanoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] (2S,3S)-2-amino-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H](N)C(=O)O[C@@H]1COC2C1OC[C@H]2OC(=O)[C@@H](N)[C@@H](C)CC |
| InChI | InChI=1S/C18H32N2O6/c1-5-9(3)13(19)17(21)25-11-7-23-16-12(8-24-15(11)16)26-18(22)14(20)10(4)6-2/h9-16H,5-8,19-20H2,1-4H3/t9-,10-,11+,12+,13-,14-,15?,16?/m0/s1 |
| InChIKey | NRJQBDDCDPZIJK-TWNBZSHFSA-N |
| XLogP | 0.35 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |