C14H27NO2 — CID 61277251
(2-ethylcyclohexyl) (2S)-2-amino-3-methylpentanoate (PubChem CID 61277251) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is (2-ethylcyclohexyl) (2S)-2-amino-3-methylpentanoate.
| Compound Name | (2-ethylcyclohexyl) (2S)-2-amino-3-methylpentanoate |
|---|---|
| PubChem CID | 61277251 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | (2-ethylcyclohexyl) (2S)-2-amino-3-methylpentanoate |
| SMILES | CCC1CCCCC1OC(=O)[C@@H](N)C(C)CC |
| InChI | InChI=1S/C14H27NO2/c1-4-10(3)13(15)14(16)17-12-9-7-6-8-11(12)5-2/h10-13H,4-9,15H2,1-3H3/t10?,11?,12?,13-/m0/s1 |
| InChIKey | GNDBFUFBOCJIGE-SKQCGHHBSA-N |
| XLogP | 2.87 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |