About (2-ethylcyclohexyl) 2-aminopropanoate
(2-ethylcyclohexyl) 2-aminopropanoate (PubChem CID 61277036) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is (2-ethylcyclohexyl) 2-aminopropanoate.
Molecular Properties
| Compound Name | (2-ethylcyclohexyl) 2-aminopropanoate |
| PubChem CID | 61277036 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | (2-ethylcyclohexyl) 2-aminopropanoate |
| SMILES | CCC1CCCCC1OC(=O)C(C)N |
| InChI | InChI=1S/C11H21NO2/c1-3-9-6-4-5-7-10(9)14-11(13)8(2)12/h8-10H,3-7,12H2,1-2H3 |
| InChIKey | MDRDIIWPZJIXLS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-ethylcyclohexyl) 2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethylcyclohexyl) 2-aminopropanoate?
The IUPAC name of (2-ethylcyclohexyl) 2-aminopropanoate (CID 61277036) is (2-ethylcyclohexyl) 2-aminopropanoate.
What is the SMILES notation for (2-ethylcyclohexyl) 2-aminopropanoate?
The canonical SMILES for (2-ethylcyclohexyl) 2-aminopropanoate is CCC1CCCCC1OC(=O)C(C)N.
What is the InChIKey of (2-ethylcyclohexyl) 2-aminopropanoate?
The InChIKey is MDRDIIWPZJIXLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-3-9-6-4-5-7-10(9)14-11(13)8(2)12/h8-10H,3-7,12H2,1-2H3.
What are the key properties of (2-ethylcyclohexyl) 2-aminopropanoate?
(2-ethylcyclohexyl) 2-aminopropanoate has a molecular weight of 199.29 g/mol, XLogP of 1.85, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethylcyclohexyl) 2-aminopropanoate is sourced from PubChem (CID 61277036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).