C17H28N2O9 — CID 142489478
[(3aR,6aR)-6-(2-amino-3-methylbutanoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 6-nitrooxyhexanoate (PubChem CID 142489478) has the molecular formula C17H28N2O9 and a molecular weight of 404.42 g/mol. Its IUPAC name is [(3aR,6aR)-6-(2-amino-3-methylbutanoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 6-nitrooxyhexanoate.
| Compound Name | [(3aR,6aR)-6-(2-amino-3-methylbutanoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 6-nitrooxyhexanoate |
|---|---|
| PubChem CID | 142489478 |
| Molecular Formula | C17H28N2O9 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | [(3aR,6aR)-6-(2-amino-3-methylbutanoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 6-nitrooxyhexanoate |
| SMILES | CC(C)C(N)C(=O)OC1CO[C@@H]2C(OC(=O)CCCCCO[N+](=O)[O-])CO[C@H]12 |
| InChI | InChI=1S/C17H28N2O9/c1-10(2)14(18)17(21)28-12-9-25-15-11(8-24-16(12)15)27-13(20)6-4-3-5-7-26-19(22)23/h10-12,14-16H,3-9,18H2,1-2H3/t11?,12?,14?,15-,16-/m1/s1 |
| InChIKey | KBOLEYCYIJCRNP-OBBLUGEKSA-N |
| XLogP | 0.36 |
| TPSA | 149.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|