About methane;2-nitrooxyethyl 2-amino-3-methylbutanoate;3-nitrooxypropyl 2-amino-3-methylbutanoate
methane;2-nitrooxyethyl 2-amino-3-methylbutanoate;3-nitrooxypropyl 2-amino-3-methylbutanoate (PubChem CID 158396182) has the molecular formula C16H34N4O10
and a molecular weight of 442.47 g/mol. Its IUPAC name is methane;2-nitrooxyethyl 2-amino-3-methylbutanoate;3-nitrooxypropyl 2-amino-3-methylbutanoate.
Molecular Properties
| Compound Name | methane;2-nitrooxyethyl 2-amino-3-methylbutanoate;3-nitrooxypropyl 2-amino-3-methylbutanoate |
| PubChem CID | 158396182 |
| Molecular Formula | C16H34N4O10 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | methane;2-nitrooxyethyl 2-amino-3-methylbutanoate;3-nitrooxypropyl 2-amino-3-methylbutanoate |
| SMILES | C.CC(C)C(N)C(=O)OCCCO[N+](=O)[O-].CC(C)C(N)C(=O)OCCO[N+](=O)[O-] |
| InChI | InChI=1S/C8H16N2O5.C7H14N2O5.CH4/c1-6(2)7(9)8(11)14-4-3-5-15-10(12)13;1-5(2)6(8)7(10)13-3-4-14-9(11)12;/h6-7H,3-5,9H2,1-2H3;5-6H,3-4,8H2,1-2H3;1H4 |
| InChIKey | GXOMGKVRUHWJCE-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 209.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methane;2-nitrooxyethyl 2-amino-3-methylbutanoate;3-nitrooxypropyl 2-amino-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-nitrooxyethyl 2-amino-3-methylbutanoate;3-nitrooxypropyl 2-amino-3-methylbutanoate?
The IUPAC name of methane;2-nitrooxyethyl 2-amino-3-methylbutanoate;3-nitrooxypropyl 2-amino-3-methylbutanoate (CID 158396182) is methane;2-nitrooxyethyl 2-amino-3-methylbutanoate;3-nitrooxypropyl 2-amino-3-methylbutanoate.
What is the SMILES notation for methane;2-nitrooxyethyl 2-amino-3-methylbutanoate;3-nitrooxypropyl 2-amino-3-methylbutanoate?
The canonical SMILES for methane;2-nitrooxyethyl 2-amino-3-methylbutanoate;3-nitrooxypropyl 2-amino-3-methylbutanoate is C.CC(C)C(N)C(=O)OCCCO[N+](=O)[O-].CC(C)C(N)C(=O)OCCO[N+](=O)[O-].
What is the InChIKey of methane;2-nitrooxyethyl 2-amino-3-methylbutanoate;3-nitrooxypropyl 2-amino-3-methylbutanoate?
The InChIKey is GXOMGKVRUHWJCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O5.C7H14N2O5.CH4/c1-6(2)7(9)8(11)14-4-3-5-15-10(12)13;1-5(2)6(8)7(10)13-3-4-14-9(11)12;/h6-7H,3-5,9H2,1-2H3;5-6H,3-4,8H2,1-2H3;1H4.
What are the key properties of methane;2-nitrooxyethyl 2-amino-3-methylbutanoate;3-nitrooxypropyl 2-amino-3-methylbutanoate?
methane;2-nitrooxyethyl 2-amino-3-methylbutanoate;3-nitrooxypropyl 2-amino-3-methylbutanoate has a molecular weight of 442.47 g/mol, XLogP of 0.47, 13 rotatable bonds, 2 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-nitrooxyethyl 2-amino-3-methylbutanoate;3-nitrooxypropyl 2-amino-3-methylbutanoate is sourced from PubChem (CID 158396182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).