About 3-nitrooxypropyl (2S)-2-amino-3-phenylpropanoate;hydrochloride
3-nitrooxypropyl (2S)-2-amino-3-phenylpropanoate;hydrochloride (PubChem CID 141103921) has the molecular formula C12H17ClN2O5
and a molecular weight of 304.73 g/mol. Its IUPAC name is 3-nitrooxypropyl (2S)-2-amino-3-phenylpropanoate;hydrochloride.
Molecular Properties
| Compound Name | 3-nitrooxypropyl (2S)-2-amino-3-phenylpropanoate;hydrochloride |
| PubChem CID | 141103921 |
| Molecular Formula | C12H17ClN2O5 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 3-nitrooxypropyl (2S)-2-amino-3-phenylpropanoate;hydrochloride |
| SMILES | Cl.N[C@@H](Cc1ccccc1)C(=O)OCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C12H16N2O5.ClH/c13-11(9-10-5-2-1-3-6-10)12(15)18-7-4-8-19-14(16)17;/h1-3,5-6,11H,4,7-9,13H2;1H/t11-;/m0./s1 |
| InChIKey | YOWVRGHPWALJSW-MERQFXBCSA-N |
| XLogP | 1.12 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitrooxypropyl (2S)-2-amino-3-phenylpropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitrooxypropyl (2S)-2-amino-3-phenylpropanoate;hydrochloride?
The IUPAC name of 3-nitrooxypropyl (2S)-2-amino-3-phenylpropanoate;hydrochloride (CID 141103921) is 3-nitrooxypropyl (2S)-2-amino-3-phenylpropanoate;hydrochloride.
What is the SMILES notation for 3-nitrooxypropyl (2S)-2-amino-3-phenylpropanoate;hydrochloride?
The canonical SMILES for 3-nitrooxypropyl (2S)-2-amino-3-phenylpropanoate;hydrochloride is Cl.N[C@@H](Cc1ccccc1)C(=O)OCCCO[N+](=O)[O-].
What is the InChIKey of 3-nitrooxypropyl (2S)-2-amino-3-phenylpropanoate;hydrochloride?
The InChIKey is YOWVRGHPWALJSW-MERQFXBCSA-N. The full InChI is InChI=1S/C12H16N2O5.ClH/c13-11(9-10-5-2-1-3-6-10)12(15)18-7-4-8-19-14(16)17;/h1-3,5-6,11H,4,7-9,13H2;1H/t11-;/m0./s1.
What are the key properties of 3-nitrooxypropyl (2S)-2-amino-3-phenylpropanoate;hydrochloride?
3-nitrooxypropyl (2S)-2-amino-3-phenylpropanoate;hydrochloride has a molecular weight of 304.73 g/mol, XLogP of 1.12, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitrooxypropyl (2S)-2-amino-3-phenylpropanoate;hydrochloride is sourced from PubChem (CID 141103921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).