C15H21N3O8 — CID 87508510
[(5S)-5,6-dinitrooxyhexyl] 2-amino-3-phenylpropanoate (PubChem CID 87508510) has the molecular formula C15H21N3O8 and a molecular weight of 371.35 g/mol. Its IUPAC name is [(5S)-5,6-dinitrooxyhexyl] 2-amino-3-phenylpropanoate.
| Compound Name | [(5S)-5,6-dinitrooxyhexyl] 2-amino-3-phenylpropanoate |
|---|---|
| PubChem CID | 87508510 |
| Molecular Formula | C15H21N3O8 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | [(5S)-5,6-dinitrooxyhexyl] 2-amino-3-phenylpropanoate |
| SMILES | NC(Cc1ccccc1)C(=O)OCCCC[C@@H](CO[N+](=O)[O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C15H21N3O8/c16-14(10-12-6-2-1-3-7-12)15(19)24-9-5-4-8-13(26-18(22)23)11-25-17(20)21/h1-3,6-7,13-14H,4-5,8-11,16H2/t13-,14?/m0/s1 |
| InChIKey | SIUCIISTTRARAW-LSLKUGRBSA-N |
| XLogP | 1.06 |
| TPSA | 157.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|