C25H28N2O12S — CID 72804120
5,6-dinitrooxyhexyl 4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate (PubChem CID 72804120) has the molecular formula C25H28N2O12S and a molecular weight of 580.57 g/mol. Its IUPAC name is 5,6-dinitrooxyhexyl 4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate.
| Compound Name | 5,6-dinitrooxyhexyl 4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate |
|---|---|
| PubChem CID | 72804120 |
| Molecular Formula | C25H28N2O12S |
| Molecular Weight | 580.57 g/mol |
| Exact Mass | 580.14 |
| IUPAC Name | 5,6-dinitrooxyhexyl 4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate |
| SMILES | CC(=O)OCC(=C(C(=O)OCCCCC(CO[N+](=O)[O-])O[N+](=O)[O-])c1ccccc1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C25H28N2O12S/c1-18(28)37-17-23(19-11-13-22(14-12-19)40(2,34)35)24(20-8-4-3-5-9-20)25(29)36-15-7-6-10-21(39-27(32)33)16-38-26(30)31/h3-5,8-9,11-14,21H,6-7,10,15-17H2,1-2H3 |
| InChIKey | PUIYGVFQHQHZGG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 191.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.57 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|