C44H46O12S2 — CID 11542411
6-[(Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoyl]oxyhexyl (Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate (PubChem CID 11542411) has the molecular formula C44H46O12S2 and a molecular weight of 830.97 g/mol. Its IUPAC name is 6-[(Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoyl]oxyhexyl (Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate.
| Compound Name | 6-[(Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoyl]oxyhexyl (Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate |
|---|---|
| PubChem CID | 11542411 |
| Molecular Formula | C44H46O12S2 |
| Molecular Weight | 830.97 g/mol |
| Exact Mass | 830.24 |
| IUPAC Name | 6-[(Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoyl]oxyhexyl (Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate |
| SMILES | CC(=O)OC/C(=C(\C(=O)OCCCCCCOC(=O)/C(=C(\COC(C)=O)c1ccc(S(C)(=O)=O)cc1)c1ccccc1)c1ccccc1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C44H46O12S2/c1-31(45)55-29-39(33-19-23-37(24-20-33)57(3,49)50)41(35-15-9-7-10-16-35)43(47)53-27-13-5-6-14-28-54-44(48)42(36-17-11-8-12-18-36)40(30-56-32(2)46)34-21-25-38(26-22-34)58(4,51)52/h7-12,15-26H,5-6,13-14,27-30H2,1-4H3/b41-39+,42-40+ |
| InChIKey | NGXZJQGOZQHVLR-LMXNTIJMSA-N |
| XLogP | 6.79 |
| TPSA | 173.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.97 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|