C36H28F4O10S2 — CID 68659315
4-[4-acetyloxy-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)but-2-enoyl]oxy-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)but-2-enoic acid (PubChem CID 68659315) has the molecular formula C36H28F4O10S2 and a molecular weight of 760.74 g/mol. Its IUPAC name is 4-[4-acetyloxy-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)but-2-enoyl]oxy-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)but-2-enoic acid.
| Compound Name | 4-[4-acetyloxy-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)but-2-enoyl]oxy-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)but-2-enoic acid |
|---|---|
| PubChem CID | 68659315 |
| Molecular Formula | C36H28F4O10S2 |
| Molecular Weight | 760.74 g/mol |
| Exact Mass | 760.11 |
| IUPAC Name | 4-[4-acetyloxy-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)but-2-enoyl]oxy-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)but-2-enoic acid |
| SMILES | CC(=O)OCC(=C(C(=O)OCC(=C(C(=O)O)c1ccc(F)c(F)c1)c1ccc(S(C)(=O)=O)cc1)c1ccc(F)c(F)c1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C36H28F4O10S2/c1-20(41)49-18-28(22-6-12-26(13-7-22)52(3,47)48)34(24-9-15-30(38)32(40)17-24)36(44)50-19-27(21-4-10-25(11-5-21)51(2,45)46)33(35(42)43)23-8-14-29(37)31(39)16-23/h4-17H,18-19H2,1-3H3,(H,42,43) |
| InChIKey | FHEJGSCDXUNMQW-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.74 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|