C29H36F2O6S — CID 11678392
[(Z)-3-(3,4-difluorophenyl)-4-methoxy-2-(4-methylsulfonylphenyl)-4-oxobut-2-enyl] 2-propyloctanoate (PubChem CID 11678392) has the molecular formula C29H36F2O6S and a molecular weight of 550.66 g/mol. Its IUPAC name is [(Z)-3-(3,4-difluorophenyl)-4-methoxy-2-(4-methylsulfonylphenyl)-4-oxobut-2-enyl] 2-propyloctanoate.
| Compound Name | [(Z)-3-(3,4-difluorophenyl)-4-methoxy-2-(4-methylsulfonylphenyl)-4-oxobut-2-enyl] 2-propyloctanoate |
|---|---|
| PubChem CID | 11678392 |
| Molecular Formula | C29H36F2O6S |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | [(Z)-3-(3,4-difluorophenyl)-4-methoxy-2-(4-methylsulfonylphenyl)-4-oxobut-2-enyl] 2-propyloctanoate |
| SMILES | CCCCCCC(CCC)C(=O)OC/C(=C(\C(=O)OC)c1ccc(F)c(F)c1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C29H36F2O6S/c1-5-7-8-9-11-21(10-6-2)28(32)37-19-24(20-12-15-23(16-13-20)38(4,34)35)27(29(33)36-3)22-14-17-25(30)26(31)18-22/h12-18,21H,5-11,19H2,1-4H3/b27-24+ |
| InChIKey | UOQAURNGDQEXCG-SOYKGTTHSA-N |
| XLogP | 6.38 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|