C26H23NO10S — CID 90702684
methyl 3-(4-methylsulfonylphenyl)-4-[3-(nitrooxymethyl)phenoxy]carbonyloxy-2-phenylbut-2-enoate (PubChem CID 90702684) has the molecular formula C26H23NO10S and a molecular weight of 541.53 g/mol. Its IUPAC name is methyl 3-(4-methylsulfonylphenyl)-4-[3-(nitrooxymethyl)phenoxy]carbonyloxy-2-phenylbut-2-enoate.
| Compound Name | methyl 3-(4-methylsulfonylphenyl)-4-[3-(nitrooxymethyl)phenoxy]carbonyloxy-2-phenylbut-2-enoate |
|---|---|
| PubChem CID | 90702684 |
| Molecular Formula | C26H23NO10S |
| Molecular Weight | 541.53 g/mol |
| Exact Mass | 541.10 |
| IUPAC Name | methyl 3-(4-methylsulfonylphenyl)-4-[3-(nitrooxymethyl)phenoxy]carbonyloxy-2-phenylbut-2-enoate |
| SMILES | COC(=O)C(=C(COC(=O)Oc1cccc(CO[N+](=O)[O-])c1)c1ccc(S(C)(=O)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H23NO10S/c1-34-25(28)24(20-8-4-3-5-9-20)23(19-11-13-22(14-12-19)38(2,32)33)17-35-26(29)37-21-10-6-7-18(15-21)16-36-27(30)31/h3-15H,16-17H2,1-2H3 |
| InChIKey | RVKOPZOVOVFOSK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 148.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|