About [3-(nitrooxymethyl)phenyl] 2-oxoethyl carbonate
[3-(nitrooxymethyl)phenyl] 2-oxoethyl carbonate (PubChem CID 91015096) has the molecular formula C10H9NO7
and a molecular weight of 255.18 g/mol. Its IUPAC name is [3-(nitrooxymethyl)phenyl] 2-oxoethyl carbonate.
Molecular Properties
| Compound Name | [3-(nitrooxymethyl)phenyl] 2-oxoethyl carbonate |
| PubChem CID | 91015096 |
| Molecular Formula | C10H9NO7 |
| Molecular Weight | 255.18 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | [3-(nitrooxymethyl)phenyl] 2-oxoethyl carbonate |
| SMILES | O=CCOC(=O)Oc1cccc(CO[N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H9NO7/c12-4-5-16-10(13)18-9-3-1-2-8(6-9)7-17-11(14)15/h1-4,6H,5,7H2 |
| InChIKey | AHOZYZSVUNUXPU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.18 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [3-(nitrooxymethyl)phenyl] 2-oxoethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(nitrooxymethyl)phenyl] 2-oxoethyl carbonate?
The IUPAC name of [3-(nitrooxymethyl)phenyl] 2-oxoethyl carbonate (CID 91015096) is [3-(nitrooxymethyl)phenyl] 2-oxoethyl carbonate.
What is the SMILES notation for [3-(nitrooxymethyl)phenyl] 2-oxoethyl carbonate?
The canonical SMILES for [3-(nitrooxymethyl)phenyl] 2-oxoethyl carbonate is O=CCOC(=O)Oc1cccc(CO[N+](=O)[O-])c1.
What is the InChIKey of [3-(nitrooxymethyl)phenyl] 2-oxoethyl carbonate?
The InChIKey is AHOZYZSVUNUXPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO7/c12-4-5-16-10(13)18-9-3-1-2-8(6-9)7-17-11(14)15/h1-4,6H,5,7H2.
What are the key properties of [3-(nitrooxymethyl)phenyl] 2-oxoethyl carbonate?
[3-(nitrooxymethyl)phenyl] 2-oxoethyl carbonate has a molecular weight of 255.18 g/mol, XLogP of 1.11, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(nitrooxymethyl)phenyl] 2-oxoethyl carbonate is sourced from PubChem (CID 91015096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).