C26H23NO9S — CID 69411387
[4-methoxy-2-(4-methylsulfonylphenyl)-4-oxo-3-phenylbut-2-enyl] 3-(nitrooxymethyl)benzoate (PubChem CID 69411387) has the molecular formula C26H23NO9S and a molecular weight of 525.54 g/mol. Its IUPAC name is [4-methoxy-2-(4-methylsulfonylphenyl)-4-oxo-3-phenylbut-2-enyl] 3-(nitrooxymethyl)benzoate.
| Compound Name | [4-methoxy-2-(4-methylsulfonylphenyl)-4-oxo-3-phenylbut-2-enyl] 3-(nitrooxymethyl)benzoate |
|---|---|
| PubChem CID | 69411387 |
| Molecular Formula | C26H23NO9S |
| Molecular Weight | 525.54 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | [4-methoxy-2-(4-methylsulfonylphenyl)-4-oxo-3-phenylbut-2-enyl] 3-(nitrooxymethyl)benzoate |
| SMILES | COC(=O)C(=C(COC(=O)c1cccc(CO[N+](=O)[O-])c1)c1ccc(S(C)(=O)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H23NO9S/c1-34-26(29)24(20-8-4-3-5-9-20)23(19-11-13-22(14-12-19)37(2,32)33)17-35-25(28)21-10-6-7-18(15-21)16-36-27(30)31/h3-15H,16-17H2,1-2H3 |
| InChIKey | MHYXQXZGOQSSFK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 139.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|