C28H29NO9S — CID 142854847
[(Z)-4-methoxy-2-(4-methylsulfonylphenyl)-4-oxo-3-phenylbut-2-enyl] (6E)-7-methyl-2-methylidene-8-nitrooxyocta-4,6-dienoate (PubChem CID 142854847) has the molecular formula C28H29NO9S and a molecular weight of 555.61 g/mol. Its IUPAC name is [(Z)-4-methoxy-2-(4-methylsulfonylphenyl)-4-oxo-3-phenylbut-2-enyl] (6E)-7-methyl-2-methylidene-8-nitrooxyocta-4,6-dienoate.
| Compound Name | [(Z)-4-methoxy-2-(4-methylsulfonylphenyl)-4-oxo-3-phenylbut-2-enyl] (6E)-7-methyl-2-methylidene-8-nitrooxyocta-4,6-dienoate |
|---|---|
| PubChem CID | 142854847 |
| Molecular Formula | C28H29NO9S |
| Molecular Weight | 555.61 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | [(Z)-4-methoxy-2-(4-methylsulfonylphenyl)-4-oxo-3-phenylbut-2-enyl] (6E)-7-methyl-2-methylidene-8-nitrooxyocta-4,6-dienoate |
| SMILES | C=C(CC=C/C=C(\C)CO[N+](=O)[O-])C(=O)OC/C(=C(\C(=O)OC)c1ccccc1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C28H29NO9S/c1-20(18-38-29(32)33)10-8-9-11-21(2)27(30)37-19-25(22-14-16-24(17-15-22)39(4,34)35)26(28(31)36-3)23-12-6-5-7-13-23/h5-10,12-17H,2,11,18-19H2,1,3-4H3/b9-8?,20-10+,26-25+ |
| InChIKey | KWWLZQMXSOMDLI-FBXUUYPGSA-N |
| XLogP | 4.37 |
| TPSA | 139.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.61 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|