C27H32N2O11S — CID 58787780
3-nitrooxypropyl (Z)-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]oxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate (PubChem CID 58787780) has the molecular formula C27H32N2O11S and a molecular weight of 592.62 g/mol. Its IUPAC name is 3-nitrooxypropyl (Z)-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]oxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate.
| Compound Name | 3-nitrooxypropyl (Z)-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]oxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate |
|---|---|
| PubChem CID | 58787780 |
| Molecular Formula | C27H32N2O11S |
| Molecular Weight | 592.62 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | 3-nitrooxypropyl (Z)-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]oxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)OC/C(=C(\C(=O)OCCCO[N+](=O)[O-])c1ccccc1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C27H32N2O11S/c1-27(2,3)40-26(32)28-17-23(30)38-18-22(19-11-13-21(14-12-19)41(4,35)36)24(20-9-6-5-7-10-20)25(31)37-15-8-16-39-29(33)34/h5-7,9-14H,8,15-18H2,1-4H3,(H,28,32)/b24-22+ |
| InChIKey | RTVNLLNPJFOFEG-ZNTNEXAZSA-N |
| XLogP | 3.21 |
| TPSA | 177.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.62 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|