C11H20N2O7 — CID 59287782
4-nitrooxybutyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 59287782) has the molecular formula C11H20N2O7 and a molecular weight of 292.29 g/mol. Its IUPAC name is 4-nitrooxybutyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | 4-nitrooxybutyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 59287782 |
| Molecular Formula | C11H20N2O7 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 4-nitrooxybutyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)OCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C11H20N2O7/c1-11(2,3)20-10(15)12-8-9(14)18-6-4-5-7-19-13(16)17/h4-8H2,1-3H3,(H,12,15) |
| InChIKey | OHWRCBMWOGOEAN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|