C17H31N3O8 — CID 59287676
2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(6-nitrooxyhexanoylamino)hexanoic acid (PubChem CID 59287676) has the molecular formula C17H31N3O8 and a molecular weight of 405.45 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(6-nitrooxyhexanoylamino)hexanoic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(6-nitrooxyhexanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 59287676 |
| Molecular Formula | C17H31N3O8 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(6-nitrooxyhexanoylamino)hexanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(CCCCNC(=O)CCCCCO[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C17H31N3O8/c1-17(2,3)28-16(24)19-13(15(22)23)9-6-7-11-18-14(21)10-5-4-8-12-27-20(25)26/h13H,4-12H2,1-3H3,(H,18,21)(H,19,24)(H,22,23) |
| InChIKey | PHFDDPNKDMCORH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 157.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|