C18H31N3O12 — CID 59287598
bis(4-nitrooxybutyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (PubChem CID 59287598) has the molecular formula C18H31N3O12 and a molecular weight of 481.46 g/mol. Its IUPAC name is bis(4-nitrooxybutyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate.
| Compound Name | bis(4-nitrooxybutyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
|---|---|
| PubChem CID | 59287598 |
| Molecular Formula | C18H31N3O12 |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | bis(4-nitrooxybutyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)OCCCCO[N+](=O)[O-])C(=O)OCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C18H31N3O12/c1-18(2,3)33-17(24)19-14(16(23)30-11-5-7-13-32-21(27)28)8-9-15(22)29-10-4-6-12-31-20(25)26/h14H,4-13H2,1-3H3,(H,19,24)/t14-/m0/s1 |
| InChIKey | MOZAPFUUJRRGIS-AWEZNQCLSA-N |
| XLogP | 1.72 |
| TPSA | 195.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|