C19H33N3O13 — CID 58812436
1-O-tert-butyl 5-O-[2-(hydroxymethyl)-3-nitrooxy-2-(nitrooxymethyl)propyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (PubChem CID 58812436) has the molecular formula C19H33N3O13 and a molecular weight of 511.48 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-[2-(hydroxymethyl)-3-nitrooxy-2-(nitrooxymethyl)propyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate.
| Compound Name | 1-O-tert-butyl 5-O-[2-(hydroxymethyl)-3-nitrooxy-2-(nitrooxymethyl)propyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
|---|---|
| PubChem CID | 58812436 |
| Molecular Formula | C19H33N3O13 |
| Molecular Weight | 511.48 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | 1-O-tert-butyl 5-O-[2-(hydroxymethyl)-3-nitrooxy-2-(nitrooxymethyl)propyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)OCC(CO)(CO[N+](=O)[O-])CO[N+](=O)[O-])C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H33N3O13/c1-17(2,3)34-15(25)13(20-16(26)35-18(4,5)6)7-8-14(24)31-10-19(9-23,11-32-21(27)28)12-33-22(29)30/h13,23H,7-12H2,1-6H3,(H,20,26)/t13-/m0/s1 |
| InChIKey | LLDWNOWLQSFCOD-ZDUSSCGKSA-N |
| XLogP | 0.94 |
| TPSA | 215.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.48 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|