C13H23NO7 — CID 13190153
(2R)-5-(2-methoxyethoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid (PubChem CID 13190153) has the molecular formula C13H23NO7 and a molecular weight of 305.33 g/mol. Its IUPAC name is (2R)-5-(2-methoxyethoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid.
| Compound Name | (2R)-5-(2-methoxyethoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 13190153 |
| Molecular Formula | C13H23NO7 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | (2R)-5-(2-methoxyethoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| SMILES | COCCOC(=O)CC[C@@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C13H23NO7/c1-13(2,3)21-12(18)14-9(11(16)17)5-6-10(15)20-8-7-19-4/h9H,5-8H2,1-4H3,(H,14,18)(H,16,17)/t9-/m1/s1 |
| InChIKey | RYDBMEGPCLWJDP-SECBINFHSA-N |
| XLogP | 0.93 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|