C15H24N2O5S — CID 167530149
tert-butyl N-[3-(2-amino-4-methylsulfonylphenoxy)propyl]carbamate (PubChem CID 167530149) has the molecular formula C15H24N2O5S and a molecular weight of 344.43 g/mol. Its IUPAC name is tert-butyl N-[3-(2-amino-4-methylsulfonylphenoxy)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-amino-4-methylsulfonylphenoxy)propyl]carbamate |
|---|---|
| PubChem CID | 167530149 |
| Molecular Formula | C15H24N2O5S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | tert-butyl N-[3-(2-amino-4-methylsulfonylphenoxy)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCOc1ccc(S(C)(=O)=O)cc1N |
| InChI | InChI=1S/C15H24N2O5S/c1-15(2,3)22-14(18)17-8-5-9-21-13-7-6-11(10-12(13)16)23(4,19)20/h6-7,10H,5,8-9,16H2,1-4H3,(H,17,18) |
| InChIKey | UCBSLDADIONKII-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|