C16H25NO6S — CID 175568199
methyl 4-ethyl-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzenesulfonate (PubChem CID 175568199) has the molecular formula C16H25NO6S and a molecular weight of 359.44 g/mol. Its IUPAC name is methyl 4-ethyl-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzenesulfonate.
| Compound Name | methyl 4-ethyl-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzenesulfonate |
|---|---|
| PubChem CID | 175568199 |
| Molecular Formula | C16H25NO6S |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | methyl 4-ethyl-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzenesulfonate |
| SMILES | CCc1ccc(S(=O)(=O)OC)cc1OCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25NO6S/c1-6-12-7-8-13(24(19,20)21-5)11-14(12)22-10-9-17-15(18)23-16(2,3)4/h7-8,11H,6,9-10H2,1-5H3,(H,17,18) |
| InChIKey | WKCZJGAYMBIRJZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|