C20H34N2O8S — CID 177247080
tert-butyl N-[2-[2-[2-[2-(4-amino-3-methoxyphenyl)sulfonylethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 177247080) has the molecular formula C20H34N2O8S and a molecular weight of 462.57 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[2-(4-amino-3-methoxyphenyl)sulfonylethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[2-(4-amino-3-methoxyphenyl)sulfonylethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 177247080 |
| Molecular Formula | C20H34N2O8S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[2-(4-amino-3-methoxyphenyl)sulfonylethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | COc1cc(S(=O)(=O)CCOCCOCCOCCNC(=O)OC(C)(C)C)ccc1N |
| InChI | InChI=1S/C20H34N2O8S/c1-20(2,3)30-19(23)22-7-8-27-9-10-28-11-12-29-13-14-31(24,25)16-5-6-17(21)18(15-16)26-4/h5-6,15H,7-14,21H2,1-4H3,(H,22,23) |
| InChIKey | ZMMOQPIQXZKMBJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 135.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|