C23H29NO7S — CID 67107745
6-(benzenesulfonylmethyl)-3-ethyl-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzoic acid (PubChem CID 67107745) has the molecular formula C23H29NO7S and a molecular weight of 463.55 g/mol. Its IUPAC name is 6-(benzenesulfonylmethyl)-3-ethyl-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzoic acid.
| Compound Name | 6-(benzenesulfonylmethyl)-3-ethyl-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 67107745 |
| Molecular Formula | C23H29NO7S |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 6-(benzenesulfonylmethyl)-3-ethyl-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzoic acid |
| SMILES | CCc1ccc(CS(=O)(=O)c2ccccc2)c(C(=O)O)c1OCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H29NO7S/c1-5-16-11-12-17(15-32(28,29)18-9-7-6-8-10-18)19(21(25)26)20(16)30-14-13-24-22(27)31-23(2,3)4/h6-12H,5,13-15H2,1-4H3,(H,24,27)(H,25,26) |
| InChIKey | FGPZYINBMYLCAI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|