C17H20N2O6 — CID 19596598
3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]-5-phenyl-1,2-oxazole-4-carboxylic acid (PubChem CID 19596598) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is 3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]-5-phenyl-1,2-oxazole-4-carboxylic acid.
| Compound Name | 3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]-5-phenyl-1,2-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 19596598 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]-5-phenyl-1,2-oxazole-4-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NCCOc1noc(-c2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C17H20N2O6/c1-17(2,3)24-16(22)18-9-10-23-14-12(15(20)21)13(25-19-14)11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3,(H,18,22)(H,20,21) |
| InChIKey | HXDKFEUVQKFDPV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 110.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|