C15H20N4O3 — CID 133482508
tert-butyl N-[2-[(5-phenyl-1,2,4-oxadiazol-3-yl)amino]ethyl]carbamate (PubChem CID 133482508) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is tert-butyl N-[2-[(5-phenyl-1,2,4-oxadiazol-3-yl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(5-phenyl-1,2,4-oxadiazol-3-yl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 133482508 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | tert-butyl N-[2-[(5-phenyl-1,2,4-oxadiazol-3-yl)amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1noc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H20N4O3/c1-15(2,3)21-14(20)17-10-9-16-13-18-12(22-19-13)11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3,(H,16,19)(H,17,20) |
| InChIKey | OTRKNQOWWUVMSE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|