C22H31N3O5 — CID 11633090
tert-butyl N-[5-[(5-ethoxy-2-phenyl-1,3-oxazole-4-carbonyl)amino]pentyl]carbamate (PubChem CID 11633090) has the molecular formula C22H31N3O5 and a molecular weight of 417.51 g/mol. Its IUPAC name is tert-butyl N-[5-[(5-ethoxy-2-phenyl-1,3-oxazole-4-carbonyl)amino]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[(5-ethoxy-2-phenyl-1,3-oxazole-4-carbonyl)amino]pentyl]carbamate |
|---|---|
| PubChem CID | 11633090 |
| Molecular Formula | C22H31N3O5 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | tert-butyl N-[5-[(5-ethoxy-2-phenyl-1,3-oxazole-4-carbonyl)amino]pentyl]carbamate |
| SMILES | CCOc1oc(-c2ccccc2)nc1C(=O)NCCCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H31N3O5/c1-5-28-20-17(25-19(29-20)16-12-8-6-9-13-16)18(26)23-14-10-7-11-15-24-21(27)30-22(2,3)4/h6,8-9,12-13H,5,7,10-11,14-15H2,1-4H3,(H,23,26)(H,24,27) |
| InChIKey | ZQFPZRWXRIRYHF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|