C20H25N3O6 — CID 135404940
(2S)-2-[(5-hydroxy-2-phenyl-1,3-oxazol-4-yl)methylideneamino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (PubChem CID 135404940) has the molecular formula C20H25N3O6 and a molecular weight of 403.44 g/mol. Its IUPAC name is (2S)-2-[(5-hydroxy-2-phenyl-1,3-oxazol-4-yl)methylideneamino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid.
| Compound Name | (2S)-2-[(5-hydroxy-2-phenyl-1,3-oxazol-4-yl)methylideneamino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 135404940 |
| Molecular Formula | C20H25N3O6 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | (2S)-2-[(5-hydroxy-2-phenyl-1,3-oxazol-4-yl)methylideneamino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCC[C@H](/N=C/c1nc(-c2ccccc2)oc1O)C(=O)O |
| InChI | InChI=1S/C20H25N3O6/c1-20(2,3)29-19(27)21-11-7-10-14(17(24)25)22-12-15-18(26)28-16(23-15)13-8-5-4-6-9-13/h4-6,8-9,12,14,26H,7,10-11H2,1-3H3,(H,21,27)(H,24,25)/b22-12+/t14-/m0/s1 |
| InChIKey | IBXNJQKOEAJYSU-OFJBCHTGSA-N |
| XLogP | 3.22 |
| TPSA | 134.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|