C10H19IN2O4 — CID 163663176
(2S)-2-(iodoamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (PubChem CID 163663176) has the molecular formula C10H19IN2O4 and a molecular weight of 358.18 g/mol. Its IUPAC name is (2S)-2-(iodoamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid.
| Compound Name | (2S)-2-(iodoamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 163663176 |
| Molecular Formula | C10H19IN2O4 |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | (2S)-2-(iodoamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCC[C@H](NI)C(=O)O |
| InChI | InChI=1S/C10H19IN2O4/c1-10(2,3)17-9(16)12-6-4-5-7(13-11)8(14)15/h7,13H,4-6H2,1-3H3,(H,12,16)(H,14,15)/t7-/m0/s1 |
| InChIKey | IWCXKEGKGVWVRW-ZETCQYMHSA-N |
| XLogP | 1.68 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|